| 2-Acetylaminofluorene | |
|---|---|
![]() |
|
| IUPAC name |
N-(9H-fluoren-2-yl)acetamide
|
| Other names | 2-Acetamidofluorene; N-2-Fluorenylacetamide |
| Identifiers | |
| Abbreviations | 2-AAF |
| CAS number | 53-96-3 |
| PubChem | 5897 |
| SMILES |
CC(=O)NC1=CC2=C(C=C1)C3=CC=CC=C3C2
|
| Properties | |
| Molecular formula | C15H13NO |
| Molar mass | 223.27 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
|
| Infobox references | |
2-Acetylaminofluorene (2-AAF) is a carcinogenic and mutagenic derivative of fluorene. It is used as a biochemical tool in the study of carcinogenesis.
|
|