| 3-Iodothyronamine | |
|---|---|
![]() |
|
| IUPAC name |
4-[4-(2-Amino-ethyl)-2-iodo-phenoxy]-phenol
|
| Other names | T1AM |
| Identifiers | |
| CAS number | 712349-95-6 |
| SMILES |
OC1=CC=C(OC2=C(I)C=C(CCN)C=C2)C=C1
|
| Properties | |
| Molecular formula | C14H14INO2 |
| Molar mass | 355.17 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
| Infobox references | |
3-iodothyronamine (T1AM) is an endogenous thyronamine. T1AM is a high-affinity ligand for the trace amine-associated receptor TAAR1 (TAR1, TA1), a G protein-coupled receptor.[1][2] When injected into rodents, T1AM causes a rapid drop in body temperature and alterations in blood pressure and heart rate.[3]
T1AM may be part of a signaling pathway to modulate cardiac function as the compound can induce negative inotropic effects and decrease cardiac output.[4]
|
||||||||||||||
|
|