| 3-Nitrobenzanthrone | |
|---|---|
 |
|
| IUPAC name |
3-Nitro-3,3a-dihydro-benzo[de]anthracen-7-one
|
| Identifiers | |
| CAS number | 17117-34-9 |
| SMILES |
O=C2C1=CC=CC=C1C4=C3C2=CC=CC3C([N+]([O-])=O)C=C4
|
| Properties | |
| Molecular formula | C17H9NO3 |
| Molar mass | 275.26 g/mol |
| Melting point |
248 °C[1] |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
| Infobox references | |
3-Nitrobenzanthrone (3-nitro-7H-benz[de]anthracen-7-one) is a chemical emitted in the exhaust fumes of diesel engines which is a potent carcinogen.[2] It produced the highest score ever reported in the Ames test, a standard measure of the cancer-causing potential of toxic chemicals, far greater than the previous known strongest 1,8-dinitropyrene which also found in diesel exhaust.[3]
  | 3-Nitrobenzanthrone, a potential human cancer hazard in diesel exhaust and urban air pollution: a review of the evidence - 3-Nitrobenzanthrone, a potential human cancer hazard in diesel exhaust and urban air pollution: a review of the evidence -- Arlt 20 (6): 399 -- Mutagenesis |
|
|
Wikis
Search
