| 3-Phosphoglyceric acid | |
|---|---|
![]() |
|
|
(2R)-2-Hydroxy-3-phosphonooxypropanoic acid
|
|
| Identifiers | |
| CAS number | 820-11-1 |
| PubChem | 439183 |
| SMILES |
C([C@H](C(=O)O)O)OP(=O)(O)O
|
| Properties | |
| Molecular formula | C3H7O7P |
| Molar mass | 186.06 g mol−1 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
| Infobox references | |
3-Phosphoglyceric acid (3PG), or glycerate 3-phosphate (GP), is a biochemically significant 3-carbon molecule that is a metabolic intermediate in both glycolysis and the Calvin cycle.[citation needed] This chemical is often termed PGA when referring to the Calvin cycle. 3-Phosphoglycerate is the resultant of the split of 6-carbon intermediate that is so unstable that it splits instantly. And two 3-phosphoglycerate molecules are produced for each molecule of CO2.
Contents |
| 1,3-bisphospho-D-glycerate | 3-phosphoglycerate kinase | 3-phospho-D-glycerate | Phosphoglyceromutase | 2-phospho-D-glycerate | ||
![]() |
![]() |
![]() |
||||
| ADP | ATP | |||||
![]() |
![]() |
|||||
| ADP | ATP | |||||
| 3-phosphoglycerate kinase | Phosphoglyceromutase | |||||
Compound C00236 at KEGG Pathway Database. Enzyme 2.7.2.3 at KEGG Pathway Database. Compound C00197 at KEGG Pathway Database. Enzyme 5.4.2.1 at KEGG Pathway Database. Compound C00631 at KEGG Pathway Database.
In the Calvin cycle, two glycerate 3-phosphate molecules are reduced to form two molecules of glyceraldehyde 3-phosphate (PGAL). This is the first compound formed during the C3 or Calvin cycle. It is a reactive biomolecule that is easily reduced.
Glycerate 3-phosphate is also a precursor for serine, which, in turn, can create cysteine and glycine through the homocysteine cycle.
| Glycolysis Metabolic Pathway | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
||||||||||||||||||||||||||||||||||||||||||||||
|
|