4-Diphosphocytidyl-2-C-methylerythritol | |
---|---|
![]() |
|
IUPAC name |
[(2R,3S,4R,5R)-5-(4-Amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl
[hydroxy-[(2R,3S)-2,3,4-trihydroxy-3-methylbutoxy]phosphoryl]
hydrogen phosphate
|
Identifiers | |
CAS number | 263016-94-0 |
PubChem | 443199 |
MeSH | 4-diphosphocytidyl-2-C-methylerythritol |
SMILES |
C[C@](CO)([C@@H](COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=CC(=NC2=O)N)O)O)O)O
|
Properties | |
Molecular formula | C14H25N3O14P2 |
Molar mass | 521.31 g/mol |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
Infobox references |
4-Diphosphocytidyl-2-C-methylerythritol (or CDP-ME) is an intermediate in the non-mevalonate pathway.
4-Diphosphocytidyl-2-C-methylerythritol | |
---|---|
[(2R,3S,4R,5R)-5-(4-Amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl [hydroxy-[(2R,3S)-2,3,4-trihydroxy-3-methylbutoxy]phosphoryl] hydrogen phosphate | |
Identifiers | |
CAS number | 263016-94-0 |
PubChem | 443199 |
MeSH | 4-diphosphocytidyl-2-C-methylerythritol |
SMILES | C[C@](CO)([C@@H](COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=CC(=NC2=O)N)O)O)O)O
|
Properties | |
Molecular formula | C14H25N3O14P2 |
Molar mass | 521.31 g/mol |
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
Infobox references |
4-Diphosphocytidyl-2-C-methylerythritol (or CDP-ME) is an intermediate in the non-mevalonate pathway.
|