| 7,12-Dimethylbenz(a)anthracene[1] | |
|---|---|
![]() |
|
| IUPAC name |
7,12-dimethylbenzo[b]phenanthrene
|
| Identifiers | |
| CAS number | 57-97-6 |
| PubChem | 6001 |
| SMILES |
CC1=C2C=CC3=CC=CC=C3C2=C(C4=CC=CC=C14)C
|
| Properties | |
| Molecular formula | C20H16 |
| Molar mass | 256.34104 |
| Melting point |
122-123 °C |
| Hazards | |
| R-phrases | R45 R22 |
| S-phrases | S53 S36/37 S45 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
|
| Infobox references | |
7,12-Dimethylbenz(a)anthracene is a powerful organ-specific laboratory carcinogen.[2] Also known as 7,12-dimethylbenz[α]anthracene or DMBA, this substance is widely used in many research laboratories studying cancer. DMBA serves as a tumor initiator by making necessary mutations. Tumor promotion can be induced with treatments of 12-O-tetradecanoylphorbol-13-acetate (TPA) in some models of two-stage carcinogenesis.[3] This allows for a greatly accelerated rate of tumor growth, making many cancer studies possible.
|
|