| 9-Aminoacridine | |
|---|---|
![]() |
|
| IUPAC name |
acridin-9-amine
|
| Identifiers | |
| CAS number | 90-45-9 |
| PubChem | 7019 |
| SMILES |
C1=CC=C2C(=C1)C(=C3C=CC=CC3=N2)N
|
| Properties | |
| Molecular formula | C13H10N2 |
| Molar mass | 194.2319 g/mol |
| Appearance | Crystalline yellow |
| Melting point |
300°C (572°F) |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
|
| Infobox references | |
9-Aminoacridine is an highly fluorescent dye used clinically as a topical antiseptic and experimentally as a mutagen, an intracellular pH indicator and a MALDI matrix.
| 9-Aminoacridine | |
|---|---|
| acridin-9-amine | |
| Identifiers | |
| CAS number | 90-45-9 |
| PubChem | 7019 |
| ChemSpider | 6752 |
| UNII | 78OY3Z0P7Z |
| SMILES | n1c3c(c(c2c1cccc2)N)cccc3
|
| InChI | InChI=1/C13H10N2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,(H2,14,15)
|
| InChI key | XJGFWWJLMVZSIG-UHFFFAOYAM
|
| Properties | |
| Molecular formula | C13H10N2 |
| Molar mass | 194.2319 g/mol |
| Appearance | Crystalline yellow |
| Melting point |
300°C (572°F) |
| (what is this?) (verify) Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
| Infobox references | |
9-Aminoacridine is an highly fluorescent dye used clinically as a topical antiseptic and experimentally as a mutagen, an intracellular pH indicator and a negative mode small molecule MALDI matrix[1].
|
|