| Acetoxyacetylaminofluorene | |
|---|---|
 |
|
| IUPAC name |
[acetyl(9H-fluoren-2-yl)amino] acetate
|
| Other names | Acetoxy AAF; NAAAF; Acetoxyacetamidofluorene; Acetoxyfluorenylacetamide; N-Acetoxy-2-acetylaminofluorene; N-Acetoxy-2-acetamidofluorene |
| Identifiers | |
| CAS number | 6098-44-8 |
| PubChem | 22469 |
| SMILES |
CC(=O)N(C1=CC2=C(C=C1)C3=CC=CC=C3C2)OC(=O)C
|
| Properties | |
| Molecular formula | C17H15NO3 |
| Molar mass | 281.31 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
| Infobox references | |
Acetoxyacetylaminofluorene is a derivative of 2-acetylaminofluorene used as a biochemical tool in the study of carcinogenesis. It forms adducts with DNA by reacting with guanine at its C-8 position.[1] This results in breaks in one strand of the DNA.
|
|
Wikis
Search
