| Chlornaphazine | |
|---|---|
 |
|
| IUPAC name |
N,N-Bis(2-chloroethyl)naphthalen-2-amine
|
| Other names | Chlornapazine; 2-Naphthylbis(chloroethyl)amine |
| Identifiers | |
| CAS number | 494-03-1 |
| PubChem | 10307 |
| SMILES |
C1=CC=C2C=C(C=CC2=C1)N(CCCl)CCCl
|
| Properties | |
| Molecular formula | C14H15Cl2N |
| Molar mass | 268.18 g mol−1 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
| Infobox references | |
Chlornaphazine, a derivative of 2-naphthylamine, is a nitrogen mustard that was developed in the 1950s for the treatment of polycythemia and Hodgkin's disease.[1] However, a high incidence of bladder cancers in patients receiving treatment with chlornaphthazine led to use of the drug being discontinued.[2]
The International Agency for Research on Cancer has listed chlornaphazine as a human carcinogen.[3]
|
|
Wikis
Search