| Dichlorodiphenyldichloroethylene | |
|---|---|
![]() |
|
![]() |
|
| IUPAC name |
1,1-bis-(4-chlorophenyl)-2,2-dichloroethene
|
| Other names | Dichlorodiphenyldichloroethylene |
| Abbreviations | p,p'-DDE |
| Identifiers | |
| CAS number | 72-55-9 |
| SMILES |
Clc1ccc(cc1)\C(=C(/Cl)Cl)c2ccc(Cl)cc2
|
| Properties | |
| Molecular formula | C14H8Cl4 |
| Molar mass | 318.02 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
|
| Infobox references | |
Dichlorodiphenyldichloroethylene (1,1-bis-(4-chlorophenyl)-2,2-dichloroethene) is the full name of DDE. This compound is formed by the loss of hydrogen chloride (dehydrohalogenation) of DDT (1,1-bis-(4-chlorophenyl)-2,2,2-trichloroethane), of which it is one of the more common breakdown products.[1] DDE is fat soluble which tends to build up in the fat of animals. Due to its stability in fat, DDE is rarely excreted from the body, and body levels tend to increase throughout life. The major exception is the excretion of DDE in breast milk, which delivers a substantial portion of the mother's DDE burden to the young animal or child.
DDE and its parent, DDT, are reproductive toxicants for certain birds species, and major reasons for the decline of the bald eagle[2], brown pelican[3] peregrine falcon, and osprey.[4] These compounds cause egg shell thinning in susceptible species, which leads to the birds crushing their eggs instead of incubating them, due to the latters' lack of resistance.[5] Birds of prey, waterfowl, and song birds are more susceptible to eggshell thinning than chickens and related species, and DDE appears to be more potent than DDT.[4]
The biological mechanism for the thinning is not entirely known, but it is believed that p,p'-DDE impairs the shell gland's ability to excrete calcium carbonate onto the developing egg.[4][6] [7][8][9] Multiple mechanisms may be at work, or different mechanisms may operate in different species.[4] Some studies have shown that although DDE levels have fallen dramatically, eggshell thickness remains 10–12 percent thinner than before DDT was first used.[10]
Some studies have indicated that DDE is an endocrine disruptor[11] and contributes to breast cancer, but more recent studies provide strong evidence that there is no relationship between DDE exposure and breast cancer.[12] What is more clear is that DDE is a weak antiandrogen.[13]
Other studies found that exposure to DDE is linked to Alzheimer's and Parkinson's disease in humans.[14] Animal studies show that organochlorine pesticides -such as DDE- are neurotoxic, cause oxidative stress, and damage the brain's dopaminergic system.[14]
|
|