| M1G | |
|---|---|
 |
|
|
pyrimido[1,2-a]purin-10(3H)-one
|
|
| Identifiers | |
| CAS number | 103408-45-3 |
| PubChem | 124218 |
| SMILES |
C1=CN2C(=O)C3=C(N=CN3)N=C2N=C1
|
| Properties | |
| Molecular formula | C8H5N5O |
| Molar mass | 187.1582 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | |
| Infobox references | |
M1G (pyrimido[1,2-a]purin-10(3H)-one) is a heterocyclic compound which is a by-product of base excision repair (BER) of a specific type of DNA adduct called M1dG. The M1dG adduct in turn is formed by a condensation reaction between guanosine nucleotides in DNA and either malondialdehyde[1] or base propenal.[2] If not repaired, these adducts are mutagenic and carcinogenic.
Malondialdehyde is an end product of lipid peroxidation[2] while base propenal is a result of DNA peroxidation.[3]
M1dG is the major endogenous DNA adduct in human beings. M1dG adducts have been detected in cell DNA in liver, leucocytes, pancreas and breast in concentrations of 1-120 per 108 nucleotides.[1] Detection and quantification of M1dG adducts in the body as measured by free M1G is a tool for detecting DNA damage that may lead to cancer. Free M1G is also biomarker for oxidative stress.[1]
   | Lipid peroxidation-DNA damage by malondialdehyde. Marnett LJ. - Lipid peroxidation-DNA damage by malondialdehyde. [Mutat Res. 1999] - PubMed Result |
|
|
Wikis
Search
